C18H17Cl2N2OS+ — CID 8653853
(2R)-3-(3,4-dichlorophenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enylpropanethioamide (PubChem CID 8653853) has the molecular formula C18H17Cl2N2OS+ and a molecular weight of 380.32 g/mol. Its IUPAC name is (2R)-3-(3,4-dichlorophenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enylpropanethioamide.
| Compound Name | (2R)-3-(3,4-dichlorophenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enylpropanethioamide |
|---|---|
| PubChem CID | 8653853 |
| Molecular Formula | C18H17Cl2N2OS+ |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (2R)-3-(3,4-dichlorophenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-oxo-N-prop-2-enylpropanethioamide |
| SMILES | C=CCNC(=S)[C@@H](C(=O)c1ccc(Cl)c(Cl)c1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c1-3-8-21-18(24)16(22-9-4-5-12(2)11-22)17(23)13-6-7-14(19)15(20)10-13/h3-7,9-11,16H,1,8H2,2H3/p+1/t16-/m1/s1 |
| InChIKey | OWLAQLDIOORJHX-MRXNPFEDSA-O |
| XLogP | 4.12 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|