C18H17Cl2N2OS+ — CID 135620292
(E)-3-(3,4-dichlorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-prop-2-enylprop-2-enethioamide (PubChem CID 135620292) has the molecular formula C18H17Cl2N2OS+ and a molecular weight of 380.32 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-prop-2-enylprop-2-enethioamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-prop-2-enylprop-2-enethioamide |
|---|---|
| PubChem CID | 135620292 |
| Molecular Formula | C18H17Cl2N2OS+ |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-prop-2-enylprop-2-enethioamide |
| SMILES | C=CCNC(=S)/C(=C(\O)c1ccc(Cl)c(Cl)c1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C18H16Cl2N2OS/c1-3-8-21-18(24)16(22-9-4-5-12(2)11-22)17(23)13-6-7-14(19)15(20)10-13/h3-7,9-11H,1,8H2,2H3,(H-,21,23,24)/p+1 |
| InChIKey | WPVIISGFZZWYJB-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|