C22H26N2OS — CID 18231099
(E)-1-(4-tert-butylphenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-(prop-2-enylamino)-3-sulfanylideneprop-1-en-1-olate (PubChem CID 18231099) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is (E)-1-(4-tert-butylphenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-(prop-2-enylamino)-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | (E)-1-(4-tert-butylphenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-(prop-2-enylamino)-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 18231099 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (E)-1-(4-tert-butylphenyl)-2-(3-methylpyridin-1-ium-1-yl)-3-(prop-2-enylamino)-3-sulfanylideneprop-1-en-1-olate |
| SMILES | C=CCNC(=S)/C(=C(\[O-])c1ccc(C(C)(C)C)cc1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C22H26N2OS/c1-6-13-23-21(26)19(24-14-7-8-16(2)15-24)20(25)17-9-11-18(12-10-17)22(3,4)5/h6-12,14-15H,1,13H2,2-5H3,(H-,23,25,26) |
| InChIKey | LCDSTYNUXGEQOB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|