C22H17Cl2F2N2O2S+ — CID 135480931
3-(3,4-dichlorophenyl)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide (PubChem CID 135480931) has the molecular formula C22H17Cl2F2N2O2S+ and a molecular weight of 482.36 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135480931 |
| Molecular Formula | C22H17Cl2F2N2O2S+ |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
| SMILES | Cc1ccc[n+](C(C(=S)Nc2ccc(OC(F)F)cc2)=C(O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H16Cl2F2N2O2S/c1-13-3-2-10-28(12-13)19(20(29)14-4-9-17(23)18(24)11-14)21(31)27-15-5-7-16(8-6-15)30-22(25)26/h2-12,22H,1H3,(H-,27,29,31)/p+1 |
| InChIKey | PTFLOQUJHIBIRI-UHFFFAOYSA-O |
| XLogP | 6.51 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|