C26H26F2N3O5S2+ — CID 135531818
3-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-(4-morpholin-4-ylsulfonylphenyl)prop-2-enethioamide (PubChem CID 135531818) has the molecular formula C26H26F2N3O5S2+ and a molecular weight of 562.64 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-(4-morpholin-4-ylsulfonylphenyl)prop-2-enethioamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-(4-morpholin-4-ylsulfonylphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135531818 |
| Molecular Formula | C26H26F2N3O5S2+ |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-N-(4-morpholin-4-ylsulfonylphenyl)prop-2-enethioamide |
| SMILES | Cc1ccc[n+](C(C(=S)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)=C(O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C26H25F2N3O5S2/c1-18-3-2-12-30(17-18)23(24(32)19-4-8-21(9-5-19)36-26(27)28)25(37)29-20-6-10-22(11-7-20)38(33,34)31-13-15-35-16-14-31/h2-12,17,26H,13-16H2,1H3,(H-,29,32,37)/p+1 |
| InChIKey | ZVWSVTXOUHCFAV-UHFFFAOYSA-O |
| XLogP | 4.23 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|