C23H19F4N2O2S2+ — CID 135530245
3-[4-(difluoromethoxy)phenyl]-N-[4-(difluoromethylsulfanyl)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide (PubChem CID 135530245) has the molecular formula C23H19F4N2O2S2+ and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[4-(difluoromethylsulfanyl)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[4-(difluoromethylsulfanyl)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135530245 |
| Molecular Formula | C23H19F4N2O2S2+ |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[4-(difluoromethylsulfanyl)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
| SMILES | Cc1ccc[n+](C(C(=S)Nc2ccc(SC(F)F)cc2)=C(O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C23H18F4N2O2S2/c1-14-3-2-12-29(13-14)19(20(30)15-4-8-17(9-5-15)31-22(24)25)21(32)28-16-6-10-18(11-7-16)33-23(26)27/h2-13,22-23H,1H3,(H-,28,30,32)/p+1 |
| InChIKey | JQRCHFACWDZHLK-UHFFFAOYSA-O |
| XLogP | 6.52 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|