C24H22F2N2OS2 — CID 3997635
3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-(2,4,5-trimethylphenyl)prop-1-en-1-olate (PubChem CID 3997635) has the molecular formula C24H22F2N2OS2 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-(2,4,5-trimethylphenyl)prop-1-en-1-olate.
| Compound Name | 3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-(2,4,5-trimethylphenyl)prop-1-en-1-olate |
|---|---|
| PubChem CID | 3997635 |
| Molecular Formula | C24H22F2N2OS2 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 3-[4-(difluoromethylsulfanyl)anilino]-2-pyridin-1-ium-1-yl-3-sulfanylidene-1-(2,4,5-trimethylphenyl)prop-1-en-1-olate |
| SMILES | Cc1cc(C)c(C([O-])=C(C(=S)Nc2ccc(SC(F)F)cc2)[n+]2ccccc2)cc1C |
| InChI | InChI=1S/C24H22F2N2OS2/c1-15-13-17(3)20(14-16(15)2)22(29)21(28-11-5-4-6-12-28)23(30)27-18-7-9-19(10-8-18)31-24(25)26/h4-14,24H,1-3H3,(H-,27,29,30) |
| InChIKey | LMMGQONIUATIPL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|