C24H18N2OS — CID 6008693
(E)-3-anilino-1-naphthalen-2-yl-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate (PubChem CID 6008693) has the molecular formula C24H18N2OS and a molecular weight of 382.49 g/mol. Its IUPAC name is (E)-3-anilino-1-naphthalen-2-yl-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | (E)-3-anilino-1-naphthalen-2-yl-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 6008693 |
| Molecular Formula | C24H18N2OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-3-anilino-1-naphthalen-2-yl-2-pyridin-1-ium-1-yl-3-sulfanylideneprop-1-en-1-olate |
| SMILES | [O-]/C(=C(\C(=S)Nc1ccccc1)[n+]1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18N2OS/c27-23(20-14-13-18-9-5-6-10-19(18)17-20)22(26-15-7-2-8-16-26)24(28)25-21-11-3-1-4-12-21/h1-17H,(H-,25,27,28) |
| InChIKey | CIBOBRUCFVLZGF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|