C22H19N2O3S+ — CID 135766327
(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135766327) has the molecular formula C22H19N2O3S+ and a molecular weight of 391.47 g/mol. Its IUPAC name is (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135766327 |
| Molecular Formula | C22H19N2O3S+ |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | O/C(=C(/C(=S)Nc1ccccc1)[n+]1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H18N2O3S/c25-21(16-9-10-18-19(15-16)27-14-13-26-18)20(24-11-5-2-6-12-24)22(28)23-17-7-3-1-4-8-17/h1-12,15H,13-14H2,(H-,23,25,28)/p+1 |
| InChIKey | BIYFCNSJISZZMK-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|