C26H26N2O4S — CID 6162604
(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-ethoxyanilino)-2-(4-ethylpyridin-1-ium-1-yl)-3-sulfanylideneprop-1-en-1-olate (PubChem CID 6162604) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is (Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-ethoxyanilino)-2-(4-ethylpyridin-1-ium-1-yl)-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | (Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-ethoxyanilino)-2-(4-ethylpyridin-1-ium-1-yl)-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 6162604 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(2-ethoxyanilino)-2-(4-ethylpyridin-1-ium-1-yl)-3-sulfanylideneprop-1-en-1-olate |
| SMILES | CCOc1ccccc1NC(=S)/C(=C(/[O-])c1ccc2c(c1)OCCO2)[n+]1ccc(CC)cc1 |
| InChI | InChI=1S/C26H26N2O4S/c1-3-18-11-13-28(14-12-18)24(26(33)27-20-7-5-6-8-21(20)30-4-2)25(29)19-9-10-22-23(17-19)32-16-15-31-22/h5-14,17H,3-4,15-16H2,1-2H3,(H-,27,29,33) |
| InChIKey | YYVDDTXYGXIHAB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|