C19H19N2O3S+ — CID 136577303
(E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-prop-2-enyl-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 136577303) has the molecular formula C19H19N2O3S+ and a molecular weight of 355.44 g/mol. Its IUPAC name is (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-prop-2-enyl-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-prop-2-enyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 136577303 |
| Molecular Formula | C19H19N2O3S+ |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-hydroxy-N-prop-2-enyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | C=CCNC(=S)/C(=C(\O)c1ccc2c(c1)OCCO2)[n+]1ccccc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-2-8-20-19(25)17(21-9-4-3-5-10-21)18(22)14-6-7-15-16(13-14)24-12-11-23-15/h2-7,9-10,13H,1,8,11-12H2,(H-,20,22,25)/p+1 |
| InChIKey | SGDGUWDLFSNJBW-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|