C18H19N2O3S+ — CID 7912701
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide (PubChem CID 7912701) has the molecular formula C18H19N2O3S+ and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide |
|---|---|
| PubChem CID | 7912701 |
| Molecular Formula | C18H19N2O3S+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-3-oxo-2-pyridin-1-ium-1-ylpropanethioamide |
| SMILES | CCNC(=S)C(C(=O)c1ccc2c(c1)OCCO2)[n+]1ccccc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-2-19-18(24)16(20-8-4-3-5-9-20)17(21)13-6-7-14-15(12-13)23-11-10-22-14/h3-9,12,16H,2,10-11H2,1H3/p+1 |
| InChIKey | UZJLWBAZJMVOSL-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|