C19H20N2O4S — CID 8653655
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanimidothioate (PubChem CID 8653655) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanimidothioate.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanimidothioate |
|---|---|
| PubChem CID | 8653655 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-ethyl-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-oxopropanimidothioate |
| SMILES | CC/N=C(\[S-])C(C(=O)c1ccc2c(c1)OCCO2)[n+]1cccc(CO)c1 |
| InChI | InChI=1S/C19H20N2O4S/c1-2-20-19(26)17(21-7-3-4-13(11-21)12-22)18(23)14-5-6-15-16(10-14)25-9-8-24-15/h3-7,10-11,17,22H,2,8-9,12H2,1H3 |
| InChIKey | YSOFKNWOUWUXQG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|