C13H15BrO3 — CID 82254705
2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutan-1-one (PubChem CID 82254705) has the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutan-1-one.
| Compound Name | 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 82254705 |
| Molecular Formula | C13H15BrO3 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutan-1-one |
| SMILES | CC(C)C(Br)C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H15BrO3/c1-8(2)12(14)13(15)9-3-4-10-11(7-9)17-6-5-16-10/h3-4,7-8,12H,5-6H2,1-2H3 |
| InChIKey | WJHVXLMPIIAODN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|