C10H8BrClO3 — CID 116863830
2-bromo-2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone (PubChem CID 116863830) has the molecular formula C10H8BrClO3 and a molecular weight of 291.53 g/mol. Its IUPAC name is 2-bromo-2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone.
| Compound Name | 2-bromo-2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone |
|---|---|
| PubChem CID | 116863830 |
| Molecular Formula | C10H8BrClO3 |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2-bromo-2-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethanone |
| SMILES | O=C(c1ccc2c(c1)OCCO2)C(Cl)Br |
| InChI | InChI=1S/C10H8BrClO3/c11-10(12)9(13)6-1-2-7-8(5-6)15-4-3-14-7/h1-2,5,10H,3-4H2 |
| InChIKey | DOQBFUNJLWTWKN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|