C13H15ClO3 — CID 82254837
2-chloro-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butan-1-one (PubChem CID 82254837) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is 2-chloro-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butan-1-one.
| Compound Name | 2-chloro-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butan-1-one |
|---|---|
| PubChem CID | 82254837 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-chloro-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)butan-1-one |
| SMILES | CCC(Cl)C(=O)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H15ClO3/c1-2-10(14)13(15)9-4-5-11-12(8-9)17-7-3-6-16-11/h4-5,8,10H,2-3,6-7H2,1H3 |
| InChIKey | KLZRYHTTWUKZJM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|