C20H16ClN2O3S2+ — CID 135537800
N-(1,3-benzodioxol-5-ylmethyl)-3-(5-chlorothiophen-2-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135537800) has the molecular formula C20H16ClN2O3S2+ and a molecular weight of 431.95 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-(5-chlorothiophen-2-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(5-chlorothiophen-2-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135537800 |
| Molecular Formula | C20H16ClN2O3S2+ |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-(5-chlorothiophen-2-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | OC(=C(C(=S)NCc1ccc2c(c1)OCO2)[n+]1ccccc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H15ClN2O3S2/c21-17-7-6-16(28-17)19(24)18(23-8-2-1-3-9-23)20(27)22-11-13-4-5-14-15(10-13)26-12-25-14/h1-10H,11-12H2,(H-,22,24,27)/p+1 |
| InChIKey | RMUUGLCANQVMNZ-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|