C21H20ClN2OS2+ — CID 135954322
(E)-3-(5-chlorothiophen-2-yl)-N-(2,4-dimethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide (PubChem CID 135954322) has the molecular formula C21H20ClN2OS2+ and a molecular weight of 415.99 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-(2,4-dimethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2,4-dimethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135954322 |
| Molecular Formula | C21H20ClN2OS2+ |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2,4-dimethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
| SMILES | Cc1ccc(NC(=S)/C(=C(\O)c2ccc(Cl)s2)[n+]2cccc(C)c2)c(C)c1 |
| InChI | InChI=1S/C21H19ClN2OS2/c1-13-6-7-16(15(3)11-13)23-21(26)19(24-10-4-5-14(2)12-24)20(25)17-8-9-18(22)27-17/h4-12H,1-3H3,(H-,23,25,26)/p+1 |
| InChIKey | NRHCORNVVSQWAK-UHFFFAOYSA-O |
| XLogP | 5.94 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|