C21H19ClN2O2S2 — CID 3663649
1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylanilino)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate (PubChem CID 3663649) has the molecular formula C21H19ClN2O2S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylanilino)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylanilino)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate |
|---|---|
| PubChem CID | 3663649 |
| Molecular Formula | C21H19ClN2O2S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-(3,4-dimethylanilino)-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-sulfanylideneprop-1-en-1-olate |
| SMILES | Cc1ccc(NC(=S)C(=C([O-])c2ccc(Cl)s2)[n+]2cccc(CO)c2)cc1C |
| InChI | InChI=1S/C21H19ClN2O2S2/c1-13-5-6-16(10-14(13)2)23-21(27)19(20(26)17-7-8-18(22)28-17)24-9-3-4-15(11-24)12-25/h3-11,25H,12H2,1-2H3,(H-,23,26,27) |
| InChIKey | IMCDFTBBXUAHFN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|