C19H16ClN2O2S2+ — CID 135761531
N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-thiophen-2-ylprop-2-enethioamide (PubChem CID 135761531) has the molecular formula C19H16ClN2O2S2+ and a molecular weight of 403.94 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-thiophen-2-ylprop-2-enethioamide.
| Compound Name | N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-thiophen-2-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135761531 |
| Molecular Formula | C19H16ClN2O2S2+ |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-thiophen-2-ylprop-2-enethioamide |
| SMILES | OCc1ccc[n+](C(C(=S)Nc2ccc(Cl)cc2)=C(O)c2cccs2)c1 |
| InChI | InChI=1S/C19H15ClN2O2S2/c20-14-5-7-15(8-6-14)21-19(25)17(18(24)16-4-2-10-26-16)22-9-1-3-13(11-22)12-23/h1-11,23H,12H2,(H-,21,24,25)/p+1 |
| InChIKey | OOCVTTVAKSMPFP-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|