C21H17ClN3O4S+ — CID 135982770
(E)-N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)prop-2-enethioamide (PubChem CID 135982770) has the molecular formula C21H17ClN3O4S+ and a molecular weight of 442.90 g/mol. Its IUPAC name is (E)-N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)prop-2-enethioamide.
| Compound Name | (E)-N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135982770 |
| Molecular Formula | C21H17ClN3O4S+ |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (E)-N-(4-chlorophenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-3-(4-nitrophenyl)prop-2-enethioamide |
| SMILES | O=[N+]([O-])c1ccc(/C(O)=C(/C(=S)Nc2ccc(Cl)cc2)[n+]2cccc(CO)c2)cc1 |
| InChI | InChI=1S/C21H16ClN3O4S/c22-16-5-7-17(8-6-16)23-21(30)19(24-11-1-2-14(12-24)13-26)20(27)15-3-9-18(10-4-15)25(28)29/h1-12,26H,13H2,(H-,23,27,30)/p+1 |
| InChIKey | WNIHISAPEVSZHJ-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|