C23H22N3O3S+ — CID 135951001
(Z)-N-(2-ethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-3-(4-nitrophenyl)prop-2-enethioamide (PubChem CID 135951001) has the molecular formula C23H22N3O3S+ and a molecular weight of 420.51 g/mol. Its IUPAC name is (Z)-N-(2-ethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-3-(4-nitrophenyl)prop-2-enethioamide.
| Compound Name | (Z)-N-(2-ethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-3-(4-nitrophenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135951001 |
| Molecular Formula | C23H22N3O3S+ |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (Z)-N-(2-ethylphenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)-3-(4-nitrophenyl)prop-2-enethioamide |
| SMILES | CCc1ccccc1NC(=S)/C(=C(/O)c1ccc([N+](=O)[O-])cc1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-3-17-8-4-5-9-20(17)24-23(30)21(25-14-6-7-16(2)15-25)22(27)18-10-12-19(13-11-18)26(28)29/h4-15H,3H2,1-2H3,(H-,24,27,30)/p+1 |
| InChIKey | VUSPPNMUAQFNPB-UHFFFAOYSA-O |
| XLogP | 5.08 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|