C23H22FN2OS+ — CID 135677294
N-(2-ethylphenyl)-3-(4-fluorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide (PubChem CID 135677294) has the molecular formula C23H22FN2OS+ and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-(4-fluorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide.
| Compound Name | N-(2-ethylphenyl)-3-(4-fluorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135677294 |
| Molecular Formula | C23H22FN2OS+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(2-ethylphenyl)-3-(4-fluorophenyl)-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
| SMILES | CCc1ccccc1NC(=S)C(=C(O)c1ccc(F)cc1)[n+]1cccc(C)c1 |
| InChI | InChI=1S/C23H21FN2OS/c1-3-17-8-4-5-9-20(17)25-23(28)21(26-14-6-7-16(2)15-26)22(27)18-10-12-19(24)13-11-18/h4-15H,3H2,1-2H3,(H-,25,27,28)/p+1 |
| InChIKey | ZAQUYTUBRYECIW-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|