C21H18FN2OS+ — CID 135413098
3-(4-fluorophenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135413098) has the molecular formula C21H18FN2OS+ and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-(4-fluorophenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135413098 |
| Molecular Formula | C21H18FN2OS+ |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-(4-fluorophenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1ccc(NC(=S)C(=C(O)c2ccc(F)cc2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C21H17FN2OS/c1-15-5-11-18(12-6-15)23-21(26)19(24-13-3-2-4-14-24)20(25)16-7-9-17(22)10-8-16/h2-14H,1H3,(H-,23,25,26)/p+1 |
| InChIKey | HVRZYBVQGWHGBU-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|