C23H23N2OS+ — CID 135797093
3-(3,4-dimethylphenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135797093) has the molecular formula C23H23N2OS+ and a molecular weight of 375.52 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-(3,4-dimethylphenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135797093 |
| Molecular Formula | C23H23N2OS+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-3-hydroxy-N-(4-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1ccc(NC(=S)C(=C(O)c2ccc(C)c(C)c2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2OS/c1-16-7-11-20(12-8-16)24-23(27)21(25-13-5-4-6-14-25)22(26)19-10-9-17(2)18(3)15-19/h4-15H,1-3H3,(H-,24,26,27)/p+1 |
| InChIKey | HXVXOLLLUZBWEW-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|