C25H27N2O2S+ — CID 135905975
(Z)-N,3-bis(3,4-dimethylphenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide (PubChem CID 135905975) has the molecular formula C25H27N2O2S+ and a molecular weight of 419.57 g/mol. Its IUPAC name is (Z)-N,3-bis(3,4-dimethylphenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide.
| Compound Name | (Z)-N,3-bis(3,4-dimethylphenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide |
|---|---|
| PubChem CID | 135905975 |
| Molecular Formula | C25H27N2O2S+ |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (Z)-N,3-bis(3,4-dimethylphenyl)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]prop-2-enethioamide |
| SMILES | Cc1ccc(NC(=S)/C(=C(/O)c2ccc(C)c(C)c2)[n+]2cccc(CO)c2)cc1C |
| InChI | InChI=1S/C25H26N2O2S/c1-16-7-9-21(12-18(16)3)24(29)23(27-11-5-6-20(14-27)15-28)25(30)26-22-10-8-17(2)19(4)13-22/h5-14,28H,15H2,1-4H3,(H-,26,29,30)/p+1 |
| InChIKey | ZLXUOSHDIUINQT-UHFFFAOYSA-O |
| XLogP | 5.02 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|