C23H22N3O5S+ — CID 135982813
(E)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-N-(4-methoxyphenyl)-3-(4-methyl-3-nitrophenyl)prop-2-enethioamide (PubChem CID 135982813) has the molecular formula C23H22N3O5S+ and a molecular weight of 452.51 g/mol. Its IUPAC name is (E)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-N-(4-methoxyphenyl)-3-(4-methyl-3-nitrophenyl)prop-2-enethioamide.
| Compound Name | (E)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-N-(4-methoxyphenyl)-3-(4-methyl-3-nitrophenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135982813 |
| Molecular Formula | C23H22N3O5S+ |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (E)-3-hydroxy-2-[3-(hydroxymethyl)pyridin-1-ium-1-yl]-N-(4-methoxyphenyl)-3-(4-methyl-3-nitrophenyl)prop-2-enethioamide |
| SMILES | COc1ccc(NC(=S)/C(=C(\O)c2ccc(C)c([N+](=O)[O-])c2)[n+]2cccc(CO)c2)cc1 |
| InChI | InChI=1S/C23H21N3O5S/c1-15-5-6-17(12-20(15)26(29)30)22(28)21(25-11-3-4-16(13-25)14-27)23(32)24-18-7-9-19(31-2)10-8-18/h3-13,27H,14H2,1-2H3,(H-,24,28,32)/p+1 |
| InChIKey | ATMZBZRJTYPZJT-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|