C17H18N3O3S+ — CID 135794899
(Z)-N-ethyl-3-hydroxy-3-(4-methyl-3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135794899) has the molecular formula C17H18N3O3S+ and a molecular weight of 344.42 g/mol. Its IUPAC name is (Z)-N-ethyl-3-hydroxy-3-(4-methyl-3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (Z)-N-ethyl-3-hydroxy-3-(4-methyl-3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135794899 |
| Molecular Formula | C17H18N3O3S+ |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (Z)-N-ethyl-3-hydroxy-3-(4-methyl-3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | CCNC(=S)/C(=C(/O)c1ccc(C)c([N+](=O)[O-])c1)[n+]1ccccc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-3-18-17(24)15(19-9-5-4-6-10-19)16(21)13-8-7-12(2)14(11-13)20(22)23/h4-11H,3H2,1-2H3,(H-,18,21,24)/p+1 |
| InChIKey | PDTLILOZJPCSPO-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|