C21H19N2OS+ — CID 135539661
(E)-3-hydroxy-3-(4-methylphenyl)-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135539661) has the molecular formula C21H19N2OS+ and a molecular weight of 347.46 g/mol. Its IUPAC name is (E)-3-hydroxy-3-(4-methylphenyl)-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-3-hydroxy-3-(4-methylphenyl)-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135539661 |
| Molecular Formula | C21H19N2OS+ |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (E)-3-hydroxy-3-(4-methylphenyl)-N-phenyl-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1ccc(/C(O)=C(/C(=S)Nc2ccccc2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C21H18N2OS/c1-16-10-12-17(13-11-16)20(24)19(23-14-6-3-7-15-23)21(25)22-18-8-4-2-5-9-18/h2-15H,1H3,(H-,22,24,25)/p+1 |
| InChIKey | CEACGMGFPCYVQZ-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 36.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|