C23H21F2N2O2S+ — CID 135473882
3-[4-(difluoromethoxy)phenyl]-N-(3,5-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135473882) has the molecular formula C23H21F2N2O2S+ and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(3,5-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(3,5-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135473882 |
| Molecular Formula | C23H21F2N2O2S+ |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(3,5-dimethylphenyl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1cc(C)cc(NC(=S)C(=C(O)c2ccc(OC(F)F)cc2)[n+]2ccccc2)c1 |
| InChI | InChI=1S/C23H20F2N2O2S/c1-15-12-16(2)14-18(13-15)26-22(30)20(27-10-4-3-5-11-27)21(28)17-6-8-19(9-7-17)29-23(24)25/h3-14,23H,1-2H3,(H-,26,28,30)/p+1 |
| InChIKey | ZMZATPCDGSUDDQ-UHFFFAOYSA-O |
| XLogP | 5.52 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|