C22H19F2N2O2S+ — CID 135785229
(Z)-3-[4-(difluoromethoxy)phenyl]-3-hydroxy-N-(2-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135785229) has the molecular formula C22H19F2N2O2S+ and a molecular weight of 413.47 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-3-hydroxy-N-(2-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-3-hydroxy-N-(2-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135785229 |
| Molecular Formula | C22H19F2N2O2S+ |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-3-hydroxy-N-(2-methylphenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1ccccc1NC(=S)/C(=C(/O)c1ccc(OC(F)F)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C22H18F2N2O2S/c1-15-7-3-4-8-18(15)25-21(29)19(26-13-5-2-6-14-26)20(27)16-9-11-17(12-10-16)28-22(23)24/h2-14,22H,1H3,(H-,25,27,29)/p+1 |
| InChIKey | ALBDNKSEJVTMEJ-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|