C23H19F4N2O3S+ — CID 135458585
N,3-bis[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide (PubChem CID 135458585) has the molecular formula C23H19F4N2O3S+ and a molecular weight of 479.48 g/mol. Its IUPAC name is N,3-bis[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide.
| Compound Name | N,3-bis[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
|---|---|
| PubChem CID | 135458585 |
| Molecular Formula | C23H19F4N2O3S+ |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | N,3-bis[4-(difluoromethoxy)phenyl]-3-hydroxy-2-(3-methylpyridin-1-ium-1-yl)prop-2-enethioamide |
| SMILES | Cc1ccc[n+](C(C(=S)Nc2ccc(OC(F)F)cc2)=C(O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C23H18F4N2O3S/c1-14-3-2-12-29(13-14)19(20(30)15-4-8-17(9-5-15)31-22(24)25)21(33)28-16-6-10-18(11-7-16)32-23(26)27/h2-13,22-23H,1H3,(H-,28,30,33)/p+1 |
| InChIKey | CJTIZYWCLSIKRG-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|