C17H17F2N2O2S+ — CID 135463377
3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135463377) has the molecular formula C17H17F2N2O2S+ and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135463377 |
| Molecular Formula | C17H17F2N2O2S+ |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-ethyl-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | CCNC(=S)C(=C(O)c1ccc(OC(F)F)cc1)[n+]1ccccc1 |
| InChI | InChI=1S/C17H16F2N2O2S/c1-2-20-16(24)14(21-10-4-3-5-11-21)15(22)12-6-8-13(9-7-12)23-17(18)19/h3-11,17H,2H2,1H3,(H-,20,22,24)/p+1 |
| InChIKey | ZPSOVXQOJNZKLB-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|