C26H22F2N3OS+ — CID 135851126
(Z)-N-(4-fluorophenyl)-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135851126) has the molecular formula C26H22F2N3OS+ and a molecular weight of 462.55 g/mol. Its IUPAC name is (Z)-N-(4-fluorophenyl)-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (Z)-N-(4-fluorophenyl)-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135851126 |
| Molecular Formula | C26H22F2N3OS+ |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | (Z)-N-(4-fluorophenyl)-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | Cc1cc(/C(O)=C(\C(=S)Nc2ccc(F)cc2)[n+]2ccccc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21F2N3OS/c1-17-16-23(18(2)31(17)22-12-8-20(28)9-13-22)25(32)24(30-14-4-3-5-15-30)26(33)29-21-10-6-19(27)7-11-21/h3-16H,1-2H3,(H-,29,32,33)/p+1 |
| InChIKey | WJOKBOXACAQQFE-UHFFFAOYSA-O |
| XLogP | 5.98 |
| TPSA | 41.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|