C23H22Cl2N3OS+ — CID 135517775
N-(2,4-dichlorophenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135517775) has the molecular formula C23H22Cl2N3OS+ and a molecular weight of 459.42 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | N-(2,4-dichlorophenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135517775 |
| Molecular Formula | C23H22Cl2N3OS+ |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-hydroxy-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | C=CCn1c(C)cc(C(O)=C(C(=S)Nc2ccc(Cl)cc2Cl)[n+]2ccccc2)c1C |
| InChI | InChI=1S/C23H21Cl2N3OS/c1-4-10-28-15(2)13-18(16(28)3)22(29)21(27-11-6-5-7-12-27)23(30)26-20-9-8-17(24)14-19(20)25/h4-9,11-14H,1,10H2,2-3H3,(H-,26,29,30)/p+1 |
| InChIKey | OCGZVFOKEXEOPZ-UHFFFAOYSA-O |
| XLogP | 6.21 |
| TPSA | 41.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|