C25H24ClN3OS — CID 3951001
2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)ethanone (PubChem CID 3951001) has the molecular formula C25H24ClN3OS and a molecular weight of 450.01 g/mol. Its IUPAC name is 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)ethanone.
| Compound Name | 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 3951001 |
| Molecular Formula | C25H24ClN3OS |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)ethanone |
| SMILES | C=CCn1c(C)cc(C(=O)CSc2nc3cc(Cl)ccc3n2Cc2ccccc2)c1C |
| InChI | InChI=1S/C25H24ClN3OS/c1-4-12-28-17(2)13-21(18(28)3)24(30)16-31-25-27-22-14-20(26)10-11-23(22)29(25)15-19-8-6-5-7-9-19/h4-11,13-14H,1,12,15-16H2,2-3H3 |
| InChIKey | IYTRPHYMAKGEDZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|