C24H18ClN3OS — CID 3354677
2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(1H-indol-3-yl)ethanone (PubChem CID 3354677) has the molecular formula C24H18ClN3OS and a molecular weight of 431.95 g/mol. Its IUPAC name is 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 3354677 |
| Molecular Formula | C24H18ClN3OS |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanyl-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2n1Cc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H18ClN3OS/c25-17-10-11-22-21(12-17)27-24(28(22)14-16-6-2-1-3-7-16)30-15-23(29)19-13-26-20-9-5-4-8-18(19)20/h1-13,26H,14-15H2 |
| InChIKey | LLJPOTKORSFTJS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |