C25H18ClN3O2S — CID 2089345
3-benzyl-7-chloro-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 2089345) has the molecular formula C25H18ClN3O2S and a molecular weight of 459.96 g/mol. Its IUPAC name is 3-benzyl-7-chloro-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-benzyl-7-chloro-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2089345 |
| Molecular Formula | C25H18ClN3O2S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3-benzyl-7-chloro-2-[2-(1H-indol-3-yl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2c(=O)n1Cc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H18ClN3O2S/c26-17-10-11-19-22(12-17)28-25(29(24(19)31)14-16-6-2-1-3-7-16)32-15-23(30)20-13-27-21-9-5-4-8-18(20)21/h1-13,27H,14-15H2 |
| InChIKey | LVDIAZVBNKTOSB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |