C21H17ClN4O2S2 — CID 16502325
2-[[2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 16502325) has the molecular formula C21H17ClN4O2S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 2-[[2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 16502325 |
| Molecular Formula | C21H17ClN4O2S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 2-[[2-(1-benzyl-5-chlorobenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CSc1nc2cc(Cl)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C21H17ClN4O2S2/c22-14-6-7-17-16(10-14)24-21(26(17)11-13-4-2-1-3-5-13)30-12-18(27)25-20-15(19(23)28)8-9-29-20/h1-10H,11-12H2,(H2,23,28)(H,25,27) |
| InChIKey | HRQIVMXLZWSRCD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |