C18H18N4O3S2 — CID 9329687
2-[[2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 9329687) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-[[2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9329687 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[[2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | CCCn1c(SCC(=O)Nc2sccc2C(N)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H18N4O3S2/c1-2-8-22-17(25)11-5-3-4-6-13(11)20-18(22)27-10-14(23)21-16-12(15(19)24)7-9-26-16/h3-7,9H,2,8,10H2,1H3,(H2,19,24)(H,21,23) |
| InChIKey | DFQUCCQGJIRDAB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |