C15H13ClN4O2S2 — CID 47046613
2-[[2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 47046613) has the molecular formula C15H13ClN4O2S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-[[2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 47046613 |
| Molecular Formula | C15H13ClN4O2S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[[2-(5-chloro-1-methylbenzimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | Cn1c(SCC(=O)Nc2sccc2C(N)=O)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H13ClN4O2S2/c1-20-11-3-2-8(16)6-10(11)18-15(20)24-7-12(21)19-14-9(13(17)22)4-5-23-14/h2-6H,7H2,1H3,(H2,17,22)(H,19,21) |
| InChIKey | KXFIKLTXTUVTHD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |