C20H25FN3O2+ — CID 8846186
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8846186) has the molecular formula C20H25FN3O2+ and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8846186 |
| Molecular Formula | C20H25FN3O2+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C=CCn1c(C)cc(C(=O)C[NH+](C)CC(=O)Nc2cccc(F)c2)c1C |
| InChI | InChI=1S/C20H24FN3O2/c1-5-9-24-14(2)10-18(15(24)3)19(25)12-23(4)13-20(26)22-17-8-6-7-16(21)11-17/h5-8,10-11H,1,9,12-13H2,2-4H3,(H,22,26)/p+1 |
| InChIKey | RVZXJMMZZOXXKD-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 55.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|