C21H29FN3O3+ — CID 8846302
[2-(3-fluoroanilino)-2-oxoethyl]-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-methylazanium (PubChem CID 8846302) has the molecular formula C21H29FN3O3+ and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl]-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-methylazanium.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl]-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8846302 |
| Molecular Formula | C21H29FN3O3+ |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl]-[2-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-methylazanium |
| SMILES | COCCCn1c(C)cc(C(=O)C[NH+](C)CC(=O)Nc2cccc(F)c2)c1C |
| InChI | InChI=1S/C21H28FN3O3/c1-15-11-19(16(2)25(15)9-6-10-28-4)20(26)13-24(3)14-21(27)23-18-8-5-7-17(22)12-18/h5,7-8,11-12H,6,9-10,13-14H2,1-4H3,(H,23,27)/p+1 |
| InChIKey | DKFIQEYXSXJBNY-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|