C24H23FN3O3+ — CID 9250766
[2-(2-benzoylanilino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9250766) has the molecular formula C24H23FN3O3+ and a molecular weight of 420.46 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9250766 |
| Molecular Formula | C24H23FN3O3+ |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl]-[2-(3-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(F)c1)CC(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22FN3O3/c1-28(15-22(29)26-19-11-7-10-18(25)14-19)16-23(30)27-21-13-6-5-12-20(21)24(31)17-8-3-2-4-9-17/h2-14H,15-16H2,1H3,(H,26,29)(H,27,30)/p+1 |
| InChIKey | LVOLEXWEYQBTES-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |