C19H21FN3O4+ — CID 9250680
[2-(3-fluoroanilino)-2-oxoethyl]-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9250680) has the molecular formula C19H21FN3O4+ and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl]-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl]-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9250680 |
| Molecular Formula | C19H21FN3O4+ |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl]-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
| SMILES | COC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H20FN3O4/c1-23(12-18(25)22-16-5-3-4-14(20)10-16)11-17(24)21-15-8-6-13(7-9-15)19(26)27-2/h3-10H,11-12H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | YBOLPCPEDIXLLU-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |