C18H20FN2O3+ — CID 9035142
(2-fluorophenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9035142) has the molecular formula C18H20FN2O3+ and a molecular weight of 331.37 g/mol. Its IUPAC name is (2-fluorophenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2-fluorophenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9035142 |
| Molecular Formula | C18H20FN2O3+ |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2-fluorophenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
| SMILES | COC(=O)c1ccc(NC(=O)C[NH+](C)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-21(11-14-5-3-4-6-16(14)19)12-17(22)20-15-9-7-13(8-10-15)18(23)24-2/h3-10H,11-12H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | UYAIERLIDHJZEB-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |