C18H16FNO5 — CID 7796353
methyl 4-[[2-[2-(2-fluorophenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7796353) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is methyl 4-[[2-[2-(2-fluorophenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(2-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7796353 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 4-[[2-[2-(2-fluorophenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)COC(=O)Cc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H16FNO5/c1-24-18(23)12-6-8-14(9-7-12)20-16(21)11-25-17(22)10-13-4-2-3-5-15(13)19/h2-9H,10-11H2,1H3,(H,20,21) |
| InChIKey | MKKYTAMQSFYIAQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |