C25H26N3O4+ — CID 2113876
[2-(2-benzoylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 2113876) has the molecular formula C25H26N3O4+ and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-(2-benzoylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(2-benzoylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2113876 |
| Molecular Formula | C25H26N3O4+ |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | [2-(2-benzoylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-28(16-23(29)26-19-12-14-20(32-2)15-13-19)17-24(30)27-22-11-7-6-10-21(22)25(31)18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H,26,29)(H,27,30)/p+1 |
| InChIKey | SUCDNXOGYZZCHH-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |