C18H21F2NO2S — CID 60601831
2-(2,4-difluorophenyl)sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 60601831) has the molecular formula C18H21F2NO2S and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 60601831 |
| Molecular Formula | C18H21F2NO2S |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COCCCn1c(C)cc(C(=O)CSc2ccc(F)cc2F)c1C |
| InChI | InChI=1S/C18H21F2NO2S/c1-12-9-15(13(2)21(12)7-4-8-23-3)17(22)11-24-18-6-5-14(19)10-16(18)20/h5-6,9-10H,4,7-8,11H2,1-3H3 |
| InChIKey | TXJUDRUNQFEFQB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|