C19H22ClN5O2S — CID 4821885
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone (PubChem CID 4821885) has the molecular formula C19H22ClN5O2S and a molecular weight of 419.94 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 4821885 |
| Molecular Formula | C19H22ClN5O2S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-[1-(3-methoxypropyl)-2,5-dimethylpyrrol-3-yl]ethanone |
| SMILES | COCCCn1c(C)cc(C(=O)CSc2nnnn2-c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C19H22ClN5O2S/c1-13-11-17(14(2)24(13)9-4-10-27-3)18(26)12-28-19-21-22-23-25(19)16-7-5-15(20)6-8-16/h5-8,11H,4,9-10,12H2,1-3H3 |
| InChIKey | PNPNOSRHOSLQMJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|